CymitQuimica logo

CAS 97171-77-2

:

Decanoic acid, oxybis(2,1-ethanediyloxy-2,1-ethanediyl) ester

Description:
Decanoic acid, oxybis(2,1-ethanediyloxy-2,1-ethanediyl) ester, also known by its CAS number 97171-77-2, is an ester derived from decanoic acid and a diethylene glycol moiety. This compound typically exhibits characteristics common to esters, such as being a colorless to pale yellow liquid with a pleasant odor. It is generally soluble in organic solvents and has limited solubility in water due to its hydrophobic decanoic acid component. The presence of the oxybis(2,1-ethanediyloxy) group contributes to its potential as a plasticizer or surfactant, enhancing its compatibility with various polymers and improving flexibility. Additionally, this compound may possess low toxicity and is often evaluated for its biodegradability, making it suitable for applications in food, cosmetics, and pharmaceuticals. Its chemical structure suggests that it may also exhibit emulsifying properties, which can be beneficial in formulations requiring stable mixtures of oil and water. Overall, this compound's unique properties make it valuable in various industrial and consumer applications.
Formula:C28H54O7
InChI:InChI=1S/C28H54O7/c1-3-5-7-9-11-13-15-17-27(29)34-25-23-32-21-19-31-20-22-33-24-26-35-28(30)18-16-14-12-10-8-6-4-2/h3-26H2,1-2H3
InChI key:InChIKey=BUMOOGTZPQBZFW-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCOCCOC(CCCCCCCCC)=O)(CCCCCCCCC)=O
Synonyms:
  • Decanoic acid, oxybis(2,1-ethanediyloxy-2,1-ethanediyl) ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.