CAS 97173-34-7

1,1′-(Hydroxyimino)bis[2-propanol]

Description:

1,1′-(Hydroxyimino)bis[2-propanol], with the CAS number 97173-34-7, is a chemical compound characterized by its unique structure that includes two propanol groups linked by a hydroxyimino functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in water and various organic solvents, which enhances its utility in chemical reactions and formulations. The presence of the hydroxyimino group imparts specific reactivity, making it a potential candidate for use in organic synthesis, particularly in the formation of oximes and other nitrogen-containing compounds. Additionally, its hydroxyl groups contribute to hydrogen bonding capabilities, influencing its physical properties and interactions with other substances. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 1,1′-(Hydroxyimino)bis[2-propanol] is a versatile compound with applications in various fields, including pharmaceuticals and materials science.

Formula: C₆H₁₅NO₃

InChI: InChI=1S/C6H15NO3/c1-5(8)3-7(10)4-6(2)9/h5-6,8-10H,3-4H2,1-2H3

InChI key: InChIKey=JYOCWMVETLTCNF-UHFFFAOYSA-N

SMILES: C(N(CC(C)O)O)C(C)O

Synonyms:

• 1,1′-(Hydroxyimino)bis[2-propanol]
• 2-Propanol, 1,1′-(hydroxyimino)bis-

2-Propanol, 1,1'-(hydroxyimino)bis-

CAS: 97173-34-7

Formula: C₆H₁₅NO₃

Color and Shape: Solid

Molecular weight: 149.1882

Ref: IN-DA003965

1,1′-(Hydroxyazanediyl)bis(propan-2-ol)

CAS: 97173-34-7

Formula: C₆H₁₅NO₃

Purity: 95.0%

Molecular weight: 149.19

Ref: 10-F546580