CAS 97187-28-5

1,2-Benzenedimethanesulfonic acid disodium salt

Description:

1,2-Benzenedimethanesulfonic acid disodium salt, with the CAS number 97187-28-5, is a chemical compound characterized by its sulfonic acid functional groups attached to a benzene ring. This compound is typically used as a reagent in various chemical reactions and applications, including organic synthesis and as a buffering agent. It is soluble in water, which enhances its utility in aqueous solutions. The disodium salt form indicates that it has two sodium ions associated with the sulfonic acid groups, which contributes to its ionic nature and solubility. The presence of the sulfonic acid groups imparts strong acidic properties, making it useful in catalysis and as a pH regulator. Additionally, its structure allows for potential applications in pharmaceuticals and materials science. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 1,2-Benzenedimethanesulfonic acid disodium salt is a versatile compound with significant applications in various fields of chemistry.

Formula: C₈H₈Na₂O₆S₂

InChI: InChI=1/C8H10O6S2.2Na/c9-15(10,11)5-7-3-1-2-4-8(7)6-16(12,13)14;;/h1-4H,5-6H2,(H,9,10,11)(H,12,13,14);;/q;2*+1/p-2

SMILES: c1ccc(CS(=O)(=O)O)c(c1)CS(=O)(=O)O.[Na].[Na]

Synonyms:

• 1,2-Benzenedimethanesulfonic Acid, Sodium Salt (1:2)
• Disodium 1,2-phenylenedimethanesulfonate
• Disodium Benzene-1,2-Diyldimethanesulfonate