
CAS 97191-42-9
:18-Hydroxy-16-tritriacontanone
Description:
18-Hydroxy-16-tritriacontanone, with the CAS number 97191-42-9, is a long-chain fatty alcohol derivative characterized by its unique structure, which includes a hydroxyl group and a ketone functional group. This compound is part of the class of lipids and is typically found in various biological systems, particularly in the context of waxes and cuticular lipids. Its long hydrocarbon chain contributes to its hydrophobic properties, making it insoluble in water but soluble in organic solvents. The presence of the hydroxyl group imparts some degree of polarity, which can influence its interactions with other molecules. This compound may play a role in biological processes such as membrane structure and function, as well as in the formation of protective coatings in plants and animals. Additionally, due to its structural characteristics, it may have applications in the fields of biochemistry, materials science, and potentially in the development of surfactants or emulsifiers. Further studies would be necessary to fully elucidate its biological functions and potential applications.
Formula:C33H66O2
InChI:InChI=1S/C33H66O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-32(34)31-33(35)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h32,34H,3-31H2,1-2H3
InChI key:InChIKey=YICMKZPWMNXNFS-UHFFFAOYSA-N
SMILES:C(CC(CCCCCCCCCCCCCCC)=O)(CCCCCCCCCCCCCCC)O
Synonyms:- 16-Tritriacontanone, 18-hydroxy-
- 18-Hydroxy-16-tritriacontanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
18-Hydroxytritriacontan-16-one
CAS:18-Hydroxytritriacontan-16-one is a natural product for research related to life sciences. The catalog number is TN5827 and the CAS number is 97191-42-9.Formula:C33H66O2Purity:98%Color and Shape:SolidMolecular weight:494.8818-Hydroxytritriacontan-16-one
CAS:18-Hydroxytritriacontan-16-one is a naturally occurring fatty acid ketone, which is typically sourced from specific plant waxes and marine organisms. This compound is characterized by a long carbon chain, which confers particular physical and chemical properties. Its mode of action is primarily speculative at present, but it is believed to interact with cellular membranes and may potentially exhibit roles in modulating membrane fluidity or acting as a precursor in biosynthetic pathways of bioactive lipids.Formula:C33H66O2Purity:Min. 95%Molecular weight:494.9 g/mol


