
CAS 97205-35-1
:2-Pyrrolidinone, 4-(aminomethyl)-1-(phenylmethyl)-, (2E)-2-butenedioate (2:1)
Description:
2-Pyrrolidinone, 4-(aminomethyl)-1-(phenylmethyl)-, (2E)-2-butenedioate (2:1), with CAS number 97205-35-1, is a chemical compound that features a pyrrolidinone ring, which is a five-membered lactam. This compound contains an aminomethyl group and a phenylmethyl substituent, contributing to its unique properties. The presence of the (2E)-2-butenedioate moiety indicates that it has a conjugated system, which may impart certain reactivity and stability characteristics. Typically, compounds of this nature may exhibit solubility in polar solvents due to the presence of functional groups capable of hydrogen bonding. The molecular structure suggests potential applications in pharmaceuticals or as intermediates in organic synthesis, particularly due to the presence of both amine and carboxylate functionalities. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. However, specific properties such as melting point, boiling point, and reactivity would need to be determined through experimental data or literature for precise applications and handling guidelines.
Formula:C12H16N2OC4H4O4
InChI:InChI=1S/C12H16N2O.C4H4O4/c13-7-11-6-12(15)14(9-11)8-10-4-2-1-3-5-10;5-3(6)1-2-4(7)8/h1-5,11H,6-9,13H2;1-2H,(H,5,6)(H,7,8)/b;2-1+
InChI key:InChIKey=YCISRISURLUIBU-WLHGVMLRSA-N
SMILES:C(N1C(=O)CC(CN)C1)C2=CC=CC=C2.C(=C/C(O)=O)\C(O)=O
Synonyms:- Nebracetam fumarate
- 2-Pyrrolidinone, 4-(aminomethyl)-1-(phenylmethyl)-, (E)-2-butenedioate (2:1)
- 2-Pyrrolidinone, 4-(aminomethyl)-1-(phenylmethyl)-, (2E)-2-butenedioate (2:1)
- Web 1881FU
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.