CAS 97216-17-6

2-Pyrrolidinecarboxamide, N-2-naphthalenyl-, hydrobromide (1:1)

Description:

2-Pyrrolidinecarboxamide, N-2-naphthalenyl-, hydrobromide (1:1) is a chemical compound characterized by its structural features, which include a pyrrolidine ring and a naphthalene moiety. The presence of the hydrobromide indicates that it is a salt formed with hydrobromic acid, enhancing its solubility in polar solvents. This compound may exhibit properties typical of amides, such as potential hydrogen bonding capabilities, which can influence its reactivity and interaction with biological systems. The naphthalene group contributes to its aromatic characteristics, potentially affecting its electronic properties and stability. As a hydrobromide salt, it may also display different physical properties compared to its free base form, such as altered melting points and solubility profiles. This compound could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may interact with biological targets. However, specific applications and biological activities would require further investigation through empirical studies.

Formula: C₁₅H₁₆N₂O·BrH

InChI: InChI=1S/C15H16N2O.BrH/c18-15(14-6-3-9-16-14)17-13-8-7-11-4-1-2-5-12(11)10-13;/h1-2,4-5,7-8,10,14,16H,3,6,9H2,(H,17,18);1H

InChI key: InChIKey=FANPRXOKXYXAGT-UHFFFAOYSA-N

SMILES: N(C(=O)C1CCCN1)C2=CC3=C(C=C2)C=CC=C3.Br

Synonyms:

• 2-Pyrrolidinecarboxamide, N-2-naphthalenyl-, hydrobromide (1:1)
• 2-Pyrrolidinecarboxamide, N-2-naphthyl-, hydrobromide

L-Proline-ß- Naphthylamide Hydrobromide extrapure, 99%

CAS: 97216-17-6

Formula: C₁₅H₁₆N₂O·HBr

Molecular weight: 321.26

Ref: SR-73978