CAS 97218-06-9

2,4-Dimethoxy-3-dibenzofuranol

Description:

2,4-Dimethoxy-3-dibenzofuranol, with the CAS number 97218-06-9, is a chemical compound that belongs to the class of dibenzofurans, which are polycyclic aromatic compounds. This substance features a dibenzofuran core structure, substituted with two methoxy groups at the 2 and 4 positions and a hydroxyl group at the 3 position. The presence of these functional groups contributes to its potential reactivity and solubility characteristics. Typically, compounds like this may exhibit interesting biological activities, making them of interest in medicinal chemistry and pharmacology. The methoxy groups can enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. Additionally, the hydroxyl group can participate in hydrogen bonding, influencing the compound's interactions with other molecules. While specific physical properties such as melting point, boiling point, and solubility may vary, they are essential for understanding the compound's behavior in various environments. Overall, 2,4-Dimethoxy-3-dibenzofuranol represents a unique structure with potential applications in various fields of research.

Formula: C₁₄H₁₂O₄

InChI: InChI=1S/C14H12O4/c1-16-11-7-9-8-5-3-4-6-10(8)18-13(9)14(17-2)12(11)15/h3-7,15H,1-2H3

InChI key: InChIKey=IPAVEOUAXMIIKX-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(C=3C(O2)=CC=CC3)=CC(OC)=C1O

Synonyms:

• 2,4-Dimethoxy-3-dibenzofuranol
• 3-Dibenzofuranol, 2,4-dimethoxy-
• Eriobofuran

3-Dibenzofuranol, 2,4-dimethoxy-

CAS: 97218-06-9

Formula: C₁₄H₁₂O₄

Purity: 96.0%

Color and Shape: Solid

Molecular weight: 244.2427

Ref: IN-DA01RBC7

Eriobofuran

CAS: 97218-06-9

Eriobofuran is a naturally occurring compound that belongs to the class of complex organic molecules. It is derived from certain plant sources, including species known for their rich secondary metabolite content. The mode of action of Eriobofuran is largely attributed to its ability to interact with biological macromolecules, potentially affecting various biochemical pathways.

Formula: C₁₄H₁₂O₄

Purity: Min. 95%

Molecular weight: 244.24 g/mol

Ref: 3D-XDA21806