CymitQuimica logo

CAS 97221-06-2

:

4-chloro-N-[2-(3-oxomorpholin-4-yl)ethyl]benzamide

Description:
4-Chloro-N-[2-(3-oxomorpholin-4-yl)ethyl]benzamide is a chemical compound characterized by its specific structural features, including a chloro substituent on a benzamide moiety and a morpholine-derived side chain. The presence of the chloro group enhances its reactivity and potential biological activity. The morpholine ring contributes to the compound's pharmacological properties, often associated with compounds that exhibit central nervous system activity. This substance is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound's CAS number, 97221-06-2, allows for precise identification in chemical databases and literature. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, 4-chloro-N-[2-(3-oxomorpholin-4-yl)ethyl]benzamide represents a class of compounds that may have significant implications in therapeutic applications.
Formula:C13H15ClN2O3
InChI:InChI=1/C13H15ClN2O3/c14-11-3-1-10(2-4-11)13(18)15-5-6-16-7-8-19-9-12(16)17/h1-4H,5-9H2,(H,15,18)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.