CAS 97231-26-0

1,3-Diamino-2-propanethiol

Description:

1,3-Diamino-2-propanethiol, also known by its CAS number 97231-26-0, is an organic compound characterized by the presence of two amino groups and a thiol group attached to a three-carbon propyl chain. This compound is typically a colorless to pale yellow liquid with a strong, sulfurous odor due to the thiol functional group. It is soluble in water and polar organic solvents, which enhances its utility in various chemical applications. The presence of amino groups allows for potential reactivity in forming amides or participating in nucleophilic substitutions, while the thiol group can engage in redox reactions and form disulfide bonds. 1,3-Diamino-2-propanethiol is often used in the synthesis of pharmaceuticals, agrochemicals, and as a building block in organic synthesis. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and storage are essential due to its potential reactivity and the odor associated with thiols.

Formula: C₃H₁₀N₂S

InChI: InChI=1S/C3H10N2S/c4-1-3(6)2-5/h3,6H,1-2,4-5H2

InChI key: InChIKey=RMUGAJWISYBOON-UHFFFAOYSA-N

SMILES: C(CN)(CN)S

Synonyms:

• 1,3-Diamino-2-propanethiol
• 2-Mercapto-1,3-diaminopropane
• 2-Propanethiol, 1,3-diamino-