
CAS 97240-03-4
:O-6-Deoxy-α-L-mannopyranosyl-(1→4)-O-6-O-acetyl-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl (3β,4α)-3-[[2-O-(6-deoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy]-23-hydroxyolean-12-en-28-oate
Description:
O-6-Deoxy-α-L-mannopyranosyl-(1→4)-O-6-O-acetyl-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl (3β,4α)-3-[[2-O-(6-deoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy]-23-hydroxyolean-12-en-28-oate, identified by CAS number 97240-03-4, is a complex glycosylated compound characterized by its intricate structure comprising multiple sugar moieties and a triterpenoid backbone. This substance features a unique arrangement of α and β glycosidic linkages, which contribute to its solubility and biological activity. The presence of acetyl groups and hydroxyl functionalities enhances its reactivity and potential interactions with biological systems. Such compounds are often studied for their pharmacological properties, including anti-inflammatory and antimicrobial activities. The specific stereochemistry of the sugar units and the oleanolic acid derivative suggest potential applications in drug development and natural product chemistry. Overall, this compound exemplifies the complexity and diversity of glycosylated natural products, which play significant roles in various biological processes.
Formula:C61H98O27
InChI:InChI=1S/C61H98O27/c1-25-36(65)40(69)44(73)51(81-25)86-48-32(23-78-27(3)63)84-50(47(76)43(48)72)80-22-31-39(68)42(71)46(75)53(83-31)88-55(77)61-18-16-56(4,5)20-29(61)28-10-11-34-57(6)14-13-35(58(7,24-62)33(57)12-15-60(34,9)59(28,8)17-19-61)85-54-49(38(67)30(64)21-79-54)87-52-45(74)41(70)37(66)26(2)82-52/h10,25-26,29-54,62,64-76H,11-24H2,1-9H3/t25-,26-,29-,30-,31+,32+,33+,34+,35-,36-,37-,38-,39+,40+,41+,42-,43+,44+,45+,46+,47+,48+,49+,50+,51-,52-,53-,54-,57-,58-,59+,60+,61-/m0/s1
InChI key:InChIKey=YYMHTAGTVKFQOP-KZYQMVRLSA-N
SMILES:C(O[C@@H]1O[C@H](CO[C@@H]2O[C@H](COC(C)=O)[C@@H](O[C@H]3[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O3)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]45[C@](C=6[C@@](C)(CC4)[C@@]7(C)[C@](CC6)([C@]8(C)[C@@](CC7)([C@@](CO)(C)[C@@H](O[C@H]9[C@H](O[C@H]%10[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O%10)[C@@H](O)[C@@H](O)CO9)CC8)[H])[H])(CC(C)(C)CC5)[H]
Synonyms:- Olean-12-en-28-oic acid, 3-[[2-O-(6-deoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy]-23-hydroxy-, O-6-deoxy-α-L-mannopyranosyl-(1→4)-O-6-O-acetyl-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl ester, (3β,4α)-
- O-6-Deoxy-α-L-mannopyranosyl-(1→4)-O-6-O-acetyl-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl (3β,4α)-3-[[2-O-(6-deoxy-α-L-mannopyranosyl)-α-L-arabinopyranosyl]oxy]-23-hydroxyolean-12-en-28-oate
- Kizuta saponin K11
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Kizuta saponin K11
CAS:Kizuta saponin K11 is a saponin derived from Kalopanax pictum var. maximowiczii leaves, which is a widely used Korean medicinal plant.Formula:C61H98O27Color and Shape:SolidMolecular weight:1263.428Kizuta saponin K11
CAS:Kizuta saponin K11 is a saponin compound, which is derived from the leaves of the Hedera helix plant, commonly known as English ivy. These saponins are glycoside compounds known for their surface-active properties, due to their amphiphilic structure, which consists of a hydrophobic aglycone linked to hydrophilic sugar moieties. This unique structure allows Kizuta saponin K11 to disrupt cellular membranes, leading to its antifungal and antibacterial activities. By integrating into lipid bilayers, it increases membrane permeability, which can result in cell lysis for certain microorganisms.Formula:C61H98O27Purity:Min. 95%Molecular weight:1,263.40 g/mol


