CymitQuimica logo

CAS 97247-37-5

:

N-(pyridin-3-ylmethyl)cyclohexanamine

Description:
N-(pyridin-3-ylmethyl)cyclohexanamine, with the CAS number 97247-37-5, is an organic compound characterized by its unique structure that combines a cyclohexanamine moiety with a pyridine ring. This compound typically exhibits properties associated with both amines and aromatic heterocycles. It is likely to be a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the amine group. The pyridine ring contributes to its basicity and may influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may exhibit biological activity, as many pyridine-containing compounds are known for their pharmacological properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. Overall, N-(pyridin-3-ylmethyl)cyclohexanamine represents a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C12H18N2
InChI:InChI=1/C12H18N2/c1-2-6-12(7-3-1)14-10-11-5-4-8-13-9-11/h4-5,8-9,12,14H,1-3,6-7,10H2
SMILES:C1CCC(CC1)NCc1cccnc1
Synonyms:
  • 3-Pyridinemethanamine, N-cyclohexyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.