CAS 97276-95-4
:methyl 2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-4,6-O-(phenylmethylidene)hexopyranoside
Description:
Methyl 2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-4,6-O-(phenylmethylidene)hexopyranoside, with CAS number 97276-95-4, is a complex organic compound characterized by its structural features that include a hexopyranoside backbone modified with a phenylmethylidene group and an isoindole derivative. This compound exhibits properties typical of glycosides, such as solubility in polar solvents and potential reactivity due to the presence of functional groups like ketones and ethers. The isoindole moiety contributes to its potential biological activity, possibly influencing interactions with biological targets. The presence of the methyl group suggests it may have enhanced lipophilicity, affecting its absorption and distribution in biological systems. Additionally, the compound's intricate structure may lead to interesting chemical reactivity, making it a candidate for further research in medicinal chemistry or as a synthetic intermediate. Overall, its unique combination of features positions it as a compound of interest in various chemical and pharmaceutical applications.
Formula:C22H21NO7
InChI:InChI=1/C22H21NO7/c1-27-22-16(23-19(25)13-9-5-6-10-14(13)20(23)26)17(24)18-15(29-22)11-28-21(30-18)12-7-3-2-4-8-12/h2-10,15-18,21-22,24H,11H2,1H3
SMILES:COC1C(C(C2C(COC(c3ccccc3)O2)O1)O)N1C(=O)c2ccccc2C1=O
Synonyms:- Methyl 4,6-O-Benzylidene-2-deoxy-2-N-phthalimido-β- D-glucopyranoside
- Methyl 4,6-O-benzylidene-2-deoxy-2-phthalimido-b-D-glucopyranoside
- Methyl 2-Deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-4,6-O-(phenylMethylene)-
- Methyl 4,6-O-Benzylidene-2-deoxy-2-N-phthalimido-β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 4,6-O-benzylidene-2-deoxy-2-phthalimido-b-D-glucopyranoside
CAS:<p>Methyl 4,6-O-benzylidene-2-deoxy-2-phthalimido-b-D-glucopyranoside is a custom synthesis that is fluorinated, methylated and monosaccharided. This compound has a CAS number of 97276-95-4, which indicates that this is an oligosaccharide. Methyl 4,6-O-benzylidene-2-deoxy-2-phthalimido (4,6) b D glucopyranoside is polysaccharide that is glycosylated and sugar. It is also complex carbohydrate with saccharide and carbonyl groups.</p>Formula:C22H21NO7Purity:Min. 95%Molecular weight:411.42 g/mol

