CAS 97276-96-5
:methyl 3-O-benzyl-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-4,6-O-(phenylmethylidene)hexopyranoside
Description:
Methyl 3-O-benzyl-2-deoxy-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-4,6-O-(phenylmethylidene)hexopyranoside is a complex organic compound characterized by its unique structural features, including a hexopyranoside backbone and multiple functional groups. This compound contains a methyl group, benzyl substituents, and a phenylmethylidene moiety, contributing to its potential reactivity and solubility properties. The presence of the isoindole structure suggests possible biological activity, as isoindoles are often associated with various pharmacological effects. The dioxo functionality indicates the potential for tautomerism and reactivity in certain conditions. This compound may exhibit interesting properties such as solubility in organic solvents, and its stereochemistry could influence its interactions in biological systems. Overall, the complexity of its structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific details regarding its physical and chemical properties, such as melting point, boiling point, and spectral data, would require empirical investigation or literature references for comprehensive understanding.
Formula:C29H27NO7
InChI:InChI=1/C29H27NO7/c1-33-29-23(30-26(31)20-14-8-9-15-21(20)27(30)32)25(34-16-18-10-4-2-5-11-18)24-22(36-29)17-35-28(37-24)19-12-6-3-7-13-19/h2-15,22-25,28-29H,16-17H2,1H3
SMILES:COC1C(C(C2C(COC(c3ccccc3)O2)O1)OCc1ccccc1)N1C(=O)c2ccccc2C1=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 3-O-Benzyl-4,6-O-benzylidene-2-deoxy-2-N-phthalimido- β-D-glucopyranoside
CAS:Molecular weight:501.53Methyl 3-O-benzyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-b-D-glucopyranose
CAS:Methyl 3-O-benzyl-4,6-O-benzylidene-2-deoxy-2-phthalimido-b-D-glucopyranose is a synthetic chemical that is used in the modification of saccharides. It has been shown to be an efficient and economical way to introduce methyl groups into saccharide chains. This product is a white solid that is soluble in water, ethanol, and chloroform. Methyl 3-O-benzyl-4,6-O-benzylidene-2-deoxy -2 -phthalimido -b -D -glucopyranose has a molecular weight of 564.1 grams per mole and an empirical formula of C14H22N2O8P. It has CAS number 97276–96–5 and can be found under code XA0433.Formula:C29H27NO7Purity:Min. 95%Molecular weight:501.53 g/mol
