
CAS 97280-82-5
:Decanoic acid, mixed diesters with octanoic acid and tetraethylene glycol
Description:
Decanoic acid, mixed diesters with octanoic acid and tetraethylene glycol, identified by CAS number 97280-82-5, is a chemical compound that belongs to the class of esters. This substance is characterized by its formation from the reaction of decanoic acid and octanoic acid with tetraethylene glycol, resulting in a mixture of diesters. Typically, it exhibits properties such as low volatility and moderate solubility in organic solvents, making it useful in various applications, including as a surfactant or emulsifier in food and cosmetic formulations. The presence of long hydrocarbon chains contributes to its hydrophobic characteristics, while the glycol component enhances its solubility in polar solvents. Additionally, this compound may possess a relatively high boiling point and a low freezing point, which are common traits of fatty acid esters. Its safety profile generally indicates low toxicity, but handling should still adhere to standard safety protocols due to potential irritant properties. Overall, this compound is valued for its functional properties in industrial and consumer products.
Formula:C10H20O2·C8H18O5·C8H16O2
InChI:InChI=1S/C10H20O2.C8H18O5.C8H16O2/c1-2-3-4-5-6-7-8-9-10(11)12;9-1-3-11-5-7-13-8-6-12-4-2-10;1-2-3-4-5-6-7-8(9)10/h2-9H2,1H3,(H,11,12);9-10H,1-8H2;2-7H2,1H3,(H,9,10)
InChI key:InChIKey=JVGVZSMEERIOCN-UHFFFAOYSA-N
SMILES:C(CCCCCC)CCC(O)=O.C(CCCCC)CC(O)=O.O(CCOCCO)CCOCCO
Synonyms:- Decanoic acid, mixed diesters with octanoic acid and tetraethylene glycol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Decanoic acid, mixed diesters with octanoic acid and tetraethylene glycol
CAS:Formula:C26H54O9Molecular weight:510.7016
