CAS 973-67-1
:5,6,7-Trimethoxy-2-phenyl-4H-1-benzopyran-4-one
Description:
5,6,7-Trimethoxy-2-phenyl-4H-1-benzopyran-4-one, with the CAS number 973-67-1, is a synthetic organic compound belonging to the class of flavonoids, specifically a benzopyran derivative. This compound features a benzopyran core structure, which is characterized by a fused benzene and pyran ring, and is substituted with three methoxy groups at the 5, 6, and 7 positions, as well as a phenyl group at the 2 position. These substitutions contribute to its unique chemical properties, including its potential for biological activity. The presence of methoxy groups enhances its lipophilicity, which may influence its interaction with biological membranes and its overall bioavailability. Additionally, compounds of this type are often studied for their antioxidant, anti-inflammatory, and anticancer properties, making them of interest in medicinal chemistry and pharmacology. The compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature, which are important considerations in its application and study.
Formula:C18H16O5
InChI:InChI=1/C18H16O5/c1-20-15-10-14-16(18(22-3)17(15)21-2)12(19)9-13(23-14)11-7-5-4-6-8-11/h4-10H,1-3H3
InChI key:InChIKey=HJNJAUYFFFOFBW-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(OC(=CC2=O)C3=CC=CC=C3)=CC(OC)=C1OC
Synonyms:- 4H-1-Benzopyran-4-one, 5,6,7-trimethoxy-2-phenyl-
- 5,6,7-Trimethoxy-2-phenyl-4H-1-benzopyran-4-one
- 5,6,7-Trimethylbaicalein
- 5,6,7-trimethoxy-2-phenyl-4H-chromen-4-one
- Baicalein trimethyl ether
- Flavone, 5,6,7-trimethoxy-
- 5,6,7-Trimethoxyflavone
- 5,6,7-Trimethoxyflavone,97%
- 2-Phenyl-5,6,7-trimethoxy-4H-1-benzopyran-4-one
- BAICALEIN-5,6,7-TRIMETHYL ETHER
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
5,6,7-Trimethoxy-2-Phenyl-4H-Chromen-4-One
CAS:5,6,7-Trimethoxy-2-Phenyl-4H-Chromen-4-OneFormula:C18H16O5Purity:99%Molecular weight:312.325,6,7-TRIMETHOXYFLAVONE
CAS:5,6,7-TRIMETHOXYFLAVONEFormula:C18H16O5Purity:≥98%Molecular weight:312.325,6,7-Trimethoxy-2-phenyl-4H-chromen-4-one
CAS:Formula:C18H16O5Purity:97%Color and Shape:SolidMolecular weight:312.3166Baicalein-5,6,7-trimethylether
CAS:Baicalein-5,6,7-trimethylether analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C18H16O5Purity:(HPLC) ≥90%Color and Shape:PowderMolecular weight:312.335,6,7-TRIMETHOXYFLAVONE
CAS:5,6,7-Trimethoxyflavone, a natural product extracted from Japanese Callicarpa, acts as a p38-α MAPK inhibitor and exhibits anti-inflammatory properties.Formula:C18H16O5Purity:99.05% - 99.49%Color and Shape:Yellow SolidMolecular weight:312.31665,6,7-Trimethoxyflavone
CAS:5,6,7-Trimethoxy-2-phenyl-4H-chromen-4-oneFormula:C18H16O5Purity:97%Molecular weight:312.325,6,7-Trimethoxyflavone
CAS:5,6,7-Trimethoxyflavone is a specialized flavonoid compound, which is derived from natural plant sources. This compound exists primarily in certain species of the plant kingdom, such as citrus fruits, where it is part of a group of polyphenolic compounds known for their diverse biological activities. Its structure is characterized by the presence of three methoxy groups at positions 5, 6, and 7 on the flavone backbone, contributing to its distinct biochemical properties.
Formula:C18H16O5Purity:Min. 95%Color and Shape:PowderMolecular weight:312.32 g/mol






