CymitQuimica logo

CAS 97310-92-4

:

3-(acetylamino)-5-methoxy-1H-indole-2-carboxylate

Description:
3-(Acetylamino)-5-methoxy-1H-indole-2-carboxylate, with the CAS number 97310-92-4, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features an acetylamino group and a methoxy group, which contribute to its unique chemical properties and potential biological activities. The presence of the carboxylate group indicates that it can exist in both protonated and deprotonated forms, depending on the pH of the environment. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with biological targets, which could lead to applications in therapeutic contexts. Additionally, the methoxy group can influence the compound's solubility and stability, while the acetylamino group may enhance its reactivity. Overall, 3-(acetylamino)-5-methoxy-1H-indole-2-carboxylate is a compound with diverse chemical characteristics that warrant further investigation for its potential applications in science and medicine.
Formula:C12H11N2O4
InChI:InChI=1/C12H12N2O4/c1-6(15)13-10-8-5-7(18-2)3-4-9(8)14-11(10)12(16)17/h3-5,14H,1-2H3,(H,13,15)(H,16,17)/p-1
SMILES:CC(=Nc1c2cc(ccc2[nH]c1C(=O)O)OC)[O-]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.