CAS 97314-22-2
:glycyl-N-[2-(acetylsulfanyl)ethyl]glycinamide trifluoroacetate (1:1)
Description:
Glycyl-N-[2-(acetylsulfanyl)ethyl]glycinamide trifluoroacetate (1:1), with the CAS number 97314-22-2, is a synthetic compound that features a combination of amino acid derivatives and a trifluoroacetate moiety. This substance is characterized by its unique structure, which includes a glycyl group and an acetylsulfanyl ethyl side chain, contributing to its potential biological activity. The trifluoroacetate component enhances its solubility and stability in various solvents, making it suitable for biochemical applications. The presence of sulfur in the acetylsulfanyl group may impart specific reactivity and interaction capabilities, particularly in biological systems. As a compound derived from amino acids, it may exhibit properties relevant to peptide synthesis, drug design, or as a biochemical probe. Its stability, solubility, and reactivity are essential for its application in research and potential therapeutic contexts. However, detailed studies on its pharmacological properties and biological effects would be necessary to fully understand its utility in scientific and medical fields.
Formula:C10H16F3N3O5S
InChI:InChI=1/C8H15N3O3S.C2HF3O2/c1-6(12)15-3-2-10-8(14)5-11-7(13)4-9;3-2(4,5)1(6)7/h2-5,9H2,1H3,(H,10,14)(H,11,13);(H,6,7)
SMILES:CC(=O)SCCN=C(CN=C(CN)O)O.C(=O)(C(F)(F)F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.