CAS 97315-76-9
:(3S)-3-fluoro-L-glutamic acid
Description:
(3S)-3-fluoro-L-glutamic acid is an amino acid derivative characterized by the presence of a fluorine atom at the third carbon of the glutamic acid backbone. This compound is a stereoisomer of glutamic acid, specifically the L-form, which is biologically relevant. It features a carboxylic acid group, an amino group, and a side chain that includes another carboxylic acid, contributing to its classification as an α-amino acid. The introduction of the fluorine atom can influence the compound's biochemical properties, potentially affecting its interaction with receptors and enzymes. (3S)-3-fluoro-L-glutamic acid is of interest in pharmaceutical research, particularly in the study of neurotransmitter systems, as it may act as a glutamate analog. Its unique structure allows for exploration in various applications, including drug design and neuropharmacology. The compound is typically handled with standard laboratory safety protocols, given its chemical reactivity and potential biological effects.
Formula:C5H8FNO4
InChI:InChI=1/C5H8FNO4/c6-2(1-3(8)9)4(7)5(10)11/h2,4H,1,7H2,(H,8,9)(H,10,11)/t2-,4-/m0/s1
SMILES:C([C@@H]([C@@H](C(=O)O)N)F)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Fluoroglutamate
CAS:3-Fluoroglutamate is a isomerase.Formula:C5H8FNO4Color and Shape:SolidMolecular weight:165.12
