CAS 97316-55-7
:Ethyl 3-cyano-2-pyridinecarboxylate
Description:
Ethyl 3-cyano-2-pyridinecarboxylate, with the CAS number 97316-55-7, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a cyano group (-CN) and an ethyl ester functional group, contributing to its reactivity and solubility properties. Ethyl 3-cyano-2-pyridinecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions. The presence of both the cyano and carboxylate groups enhances its versatility in forming derivatives. Additionally, this compound may exhibit moderate toxicity, necessitating appropriate safety measures during handling and use. Overall, its unique structural features make it a valuable intermediate in chemical synthesis.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-2-13-9(12)8-7(6-10)4-3-5-11-8/h3-5H,2H2,1H3
InChI key:InChIKey=IJGOGRHKQNKOIV-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(C#N)C=CC=N1
Synonyms:- 2-Pyridinecarboxylic Acid, 3-Cyano-, Ethyl Ester
- Ethyl 3-cyano-2-pyridinecarboxylate
- Ethyl 3-cyanopyridine-2-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethyl 3-cyanopyridine-2-carboxylate
CAS:<p>Ethyl 3-cyanopyridine-2-carboxylate</p>Color and Shape:SolidMolecular weight:176.17g/mol

