CAS 97325-55-8
:2,2'-propane-1,3-diyldipyrene
Description:
2,2'-Propane-1,3-diyldipyrene, with the CAS number 97325-55-8, is a polycyclic aromatic hydrocarbon characterized by its unique structure, which consists of two pyrene units connected by a propane-1,3-diyl linker. This compound exhibits properties typical of polycyclic aromatic hydrocarbons, including high stability and a tendency to exhibit strong fluorescence. Its molecular structure contributes to its potential applications in organic electronics, such as organic light-emitting diodes (OLEDs) and organic photovoltaics, due to its ability to facilitate charge transport and light emission. Additionally, the presence of multiple aromatic rings often leads to significant π-π stacking interactions, which can influence its solubility and aggregation behavior in various solvents. The compound's physical properties, such as melting point and solubility, can vary based on the solvent and conditions used. As with many polycyclic aromatic compounds, it is essential to consider its environmental impact and potential toxicity, particularly in relation to its persistence and bioaccumulation in ecological systems.
Formula:C35H24
InChI:InChI=1/C35H24/c1(4-22-18-28-14-10-24-6-2-7-25-11-15-29(19-22)34(28)32(24)25)5-23-20-30-16-12-26-8-3-9-27-13-17-31(21-23)35(30)33(26)27/h2-3,6-21H,1,4-5H2
SMILES:C(Cc1cc2ccc3cccc4ccc(c1)c2c34)Cc1cc2ccc3cccc4ccc(c1)c2c34
Synonyms:- Pyrene, 2,2'-(1,3-Propanediyl)Bis-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1,3-Di-(2-pyrenyl)propane
CAS:Formula:C35H24Purity:≥ 95.0%Color and Shape:White to off-white or beige solidMolecular weight:444.521,3-Di-(2-pyrenyl)propane
CAS:1,3-Di-(2-pyrenyl)propane is a synthetic molecule that has been used as a model for the phosphatidylethanolamine (PE) component of bacterial membranes. 1,3-Di-(2-pyrenyl)propane has been shown to have a phase transition temperature of -7 degrees Celsius. It is hydrophobic and highly soluble in organic solvents like chloroform, ethanol, ether, and benzene. This molecule is kinetically inert and thermodynamically stable. The monomeric form of 1,3-Di-(2-pyrenyl)propane is not sensitive to ionizing radiation. However, in the bilayer form it is highly sensitive to radiation and can lead to the formation of double bonds that can break down into radicals.
Formula:C35H24Purity:Min. 95%Color and Shape:White PowderMolecular weight:444.57 g/mol1,3-Di-(2-pyrenyl)propane
CAS:Controlled ProductFormula:C35H24Color and Shape:NeatMolecular weight:444.571,3-Di-(2-pyrenyl)propane
CAS:1,3-Di-(2-pyrenyl)propane, a fluorescent indicator, is utilized to monitor the fluidity of bacterial membrane lipids through intramolecular excimerization andFormula:C35H24Color and Shape:SolidMolecular weight:444.57



