CAS 97336-42-0

3-Ethyl-4,5-dimethyl-1H-pyrrole-2-carboxaldehyde

Description:

3-Ethyl-4,5-dimethyl-1H-pyrrole-2-carboxaldehyde is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an aldehyde functional group (-CHO) at the 2-position, contributing to its reactivity and potential applications in organic synthesis. The presence of ethyl and two methyl groups at the 3, 4, and 5 positions of the pyrrole ring enhances its hydrophobic character and may influence its biological activity. The molecular structure suggests that it could participate in various chemical reactions, such as nucleophilic additions or condensation reactions, making it valuable in the synthesis of more complex molecules. Additionally, compounds with similar structures are often studied for their potential pharmacological properties, including antimicrobial and anti-inflammatory activities. Its CAS number, 97336-42-0, allows for easy identification in chemical databases and literature. Overall, 3-Ethyl-4,5-dimethyl-1H-pyrrole-2-carboxaldehyde is a versatile compound with interesting chemical properties and potential applications in medicinal chemistry and organic synthesis.

Formula: C₉H₁₃NO

InChI: InChI=1S/C9H13NO/c1-4-8-6(2)7(3)10-9(8)5-11/h5,10H,4H2,1-3H3

InChI key: InChIKey=INRLLMQZKREWLK-UHFFFAOYSA-N

SMILES: C(C)C1=C(C=O)NC(C)=C1C

Synonyms:

• 2-Pyrrolealdehyde, 3-ethyl-4,5-dimethyl-
• 1H-Pyrrole-2-carboxaldehyde, 3-ethyl-4,5-dimethyl-
• 3-Ethyl-4,5-dimethylpyrrole-2-carboxaldehyde
• 3-Ethyl-4,5-dimethyl-1H-pyrrole-2-carboxaldehyde
• 3-Ethyl-4,5-dimethyl-pyrrole-2-carbaldehyde