CAS 97337-32-1

4,6-dichloro-7H-pyrrolo[2,3-d]pyrimidine

Description:

4,6-Dichloro-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. This compound features two chlorine atoms at the 4 and 6 positions of the pyrimidine ring, enhancing its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of chlorine substituents can influence its electronic properties, making it a candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also exhibit interesting interactions with biological targets due to its structural features. As with many heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks. Overall, 4,6-dichloro-7H-pyrrolo[2,3-d]pyrimidine is a compound of interest in both synthetic and medicinal chemistry contexts.

Formula: C₆H₃Cl₂N₃

InChI: InChI=1/C6H3Cl2N3/c7-4-1-3-5(8)9-2-10-6(3)11-4/h1-2H,(H,9,10,11)

SMILES: c1c2c(Cl)ncnc2[nH]c1Cl

Synonyms:

• 7H-pyrrolo[2,3-d]pyrimidine, 4,6-dichloro-
• 4,6-Dichloro-7H-pyrrolo[2,3-d]pyrimidine

4,6-Dichloro-7H-Pyrrolo[2,3-d]Pyrimidine

CAS: 97337-32-1

Formula: C₆H₃Cl₂N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.0141

Ref: IN-DA01A1X8

4,6-Dichloro-7H-pyrrolo[2,3-d]pyrimidine

CAS: 97337-32-1

4,6-Dichloro-7H-pyrrolo[2,3-d]pyrimidine

Purity: 97%

Molecular weight: 188.01g/mol

Ref: 54-OR87446

4,6-DICHLORO-7H-PYRROLO[2,3-D]PYRIMIDINE

CAS: 97337-32-1

Purity: 95%

Molecular weight: 188.0099945

Ref: 10-F807524