CymitQuimica logo

CAS 97347-28-9

:

tert-butyl N~2~,N~6~-bis(tert-butoxycarbonyl)-L-lysinate

Description:
Tert-butyl N^2,N^6-bis(tert-butoxycarbonyl)-L-lysinate is a chemical compound that belongs to the class of amino acid derivatives, specifically a protected form of the amino acid lysine. It features two tert-butoxycarbonyl (Boc) protecting groups attached to the amino groups of lysine, which are commonly used in peptide synthesis to protect amine functionalities during chemical reactions. The compound is typically a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but may have limited solubility in water due to its hydrophobic tert-butyl groups. Its structure allows for the selective deprotection of the amino groups under specific conditions, facilitating the synthesis of peptides and other complex molecules. The presence of the tert-butyl groups contributes to the stability and steric hindrance, making it useful in various synthetic applications in organic chemistry and biochemistry. As with many chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C20H38N2O6
InChI:InChI=1/C20H38N2O6/c1-18(2,3)26-15(23)14(22-17(25)28-20(7,8)9)12-10-11-13-21-16(24)27-19(4,5)6/h14H,10-13H2,1-9H3,(H,21,24)(H,22,25)/t14-/m0/s1
SMILES:CC(C)(C)OC(=O)[C@H](CCCCN=C(O)OC(C)(C)C)N=C(O)OC(C)(C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.