CymitQuimica logo

CAS 97347-40-5

:

tert-butyl N~2~,N~6~-bis(tert-butoxycarbonyl)-6-oxo-L-lysinate

Description:
Tert-butyl N^2,N^6-bis(tert-butoxycarbonyl)-6-oxo-L-lysinate is a synthetic organic compound primarily used in peptide synthesis and as a protecting group in organic chemistry. It features a lysine backbone, which is an essential amino acid, modified with tert-butoxycarbonyl (Boc) groups that serve to protect the amine functionalities during chemical reactions. The presence of the 6-oxo group indicates a ketone functionality, which can influence the compound's reactivity and stability. This compound is typically a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but may have limited solubility in water. Its structure allows for selective deprotection under mild acidic conditions, making it valuable in the synthesis of complex peptides. As with many chemical substances, proper handling and safety precautions are essential, as it may pose risks if ingested or inhaled. Overall, tert-butyl N^2,N^6-bis(tert-butoxycarbonyl)-6-oxo-L-lysinate is a versatile intermediate in the field of organic synthesis and medicinal chemistry.
Formula:C20H36N2O7
InChI:InChI=1/C20H36N2O7/c1-18(2,3)27-15(24)13(21-16(25)28-19(4,5)6)11-10-12-14(23)22-17(26)29-20(7,8)9/h13H,10-12H2,1-9H3,(H,21,25)(H,22,23,26)/t13-/m0/s1
SMILES:CC(C)(C)OC(=O)[C@H](CCCC(=NC(=O)OC(C)(C)C)O)N=C(O)OC(C)(C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.