CAS 97351-95-6

2-[2-(Dipropylamino)ethyl]-6-nitro-α-oxobenzenepropanoic acid

Description:

2-[2-(Dipropylamino)ethyl]-6-nitro-α-oxobenzenepropanoic acid, with the CAS number 97351-95-6, is a chemical compound that belongs to the class of amino acids and derivatives. It features a complex structure characterized by the presence of a nitro group, an α-keto acid moiety, and a dipropylamino substituent. This compound is typically recognized for its potential biological activity, particularly in pharmacological contexts, where it may exhibit properties such as enzyme inhibition or receptor modulation. The presence of the nitro group can influence its reactivity and solubility, while the dipropylamino group may enhance lipophilicity, affecting its interaction with biological membranes. Additionally, the compound's acidic nature is attributed to the carboxylic acid functional group, which can participate in various chemical reactions, including esterification and amidation. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and drug development.

Formula: C₁₇H₂₄N₂O₅

InChI: InChI=1S/C17H24N2O5/c1-3-9-18(10-4-2)11-8-13-6-5-7-15(19(23)24)14(13)12-16(20)17(21)22/h5-7H,3-4,8-12H2,1-2H3,(H,21,22)

InChI key: InChIKey=WQPYCEVULRWNEA-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)=O)C1=C(CCN(CCC)CCC)C=CC=C1N(=O)=O

Synonyms:

• 2-[2-(Dipropylamino)ethyl]-6-nitro-α-oxobenzenepropanoic acid
• Benzenepropanoic acid, 2-[2-(dipropylamino)ethyl]-6-nitro-α-oxo-

2-[2-(Dipropylamino)ethyl]-6-nitro-α-oxobenzenepropanoic Acid

Controlled Product

CAS: 97351-95-6

Applications 2-[2-(Dipropylamino)ethyl]-6-nitro-α-oxobenzenepropanoic Acid is used as a reactant in the synthesis of 4-(2-hydroxyethyl)indolin-2-one, a useful intermediate for preparation of both dopamine receptor agonists and protein kinase inhibitors.
References Matera, C., et al.: Monatsh. Chem. 145, 1139 (2014)

Formula: C₁₇H₂₄N₂O₅

Color and Shape: Neat

Molecular weight: 336.383

Ref: TR-D126820

Ropinirole Impurity 6

CAS: 97351-95-6

Formula: C₁₇H₂₄N₂O₅

Molecular weight: 336.39

Ref: ST-EA-CP-R30027