CAS 97351-95-6
:2-[2-(Dipropylamino)ethyl]-6-nitro-α-oxobenzenepropanoic acid
Description:
2-[2-(Dipropylamino)ethyl]-6-nitro-α-oxobenzenepropanoic acid, with the CAS number 97351-95-6, is a chemical compound that belongs to the class of amino acids and derivatives. It features a complex structure characterized by the presence of a nitro group, an α-keto acid moiety, and a dipropylamino substituent. This compound is typically recognized for its potential biological activity, particularly in pharmacological contexts, where it may exhibit properties such as enzyme inhibition or receptor modulation. The presence of the nitro group can influence its reactivity and solubility, while the dipropylamino group may enhance lipophilicity, affecting its interaction with biological membranes. Additionally, the compound's acidic nature is attributed to the carboxylic acid functional group, which can participate in various chemical reactions, including esterification and amidation. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and drug development.
Formula:C17H24N2O5
InChI:InChI=1S/C17H24N2O5/c1-3-9-18(10-4-2)11-8-13-6-5-7-15(19(23)24)14(13)12-16(20)17(21)22/h5-7H,3-4,8-12H2,1-2H3,(H,21,22)
InChI key:InChIKey=WQPYCEVULRWNEA-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)=O)C1=C(CCN(CCC)CCC)C=CC=C1N(=O)=O
Synonyms:- 2-[2-(Dipropylamino)ethyl]-6-nitro-α-oxobenzenepropanoic acid
- Benzenepropanoic acid, 2-[2-(dipropylamino)ethyl]-6-nitro-α-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-[2-(Dipropylamino)ethyl]-6-nitro-α-oxobenzenepropanoic Acid
CAS:Controlled ProductApplications 2-[2-(Dipropylamino)ethyl]-6-nitro-α-oxobenzenepropanoic Acid is used as a reactant in the synthesis of 4-(2-hydroxyethyl)indolin-2-one, a useful intermediate for preparation of both dopamine receptor agonists and protein kinase inhibitors.
References Matera, C., et al.: Monatsh. Chem. 145, 1139 (2014)Formula:C17H24N2O5Color and Shape:NeatMolecular weight:336.383

