CAS 97358-50-4
:N-(1,2,2-Trimethylpropyl)formamide
Description:
N-(1,2,2-Trimethylpropyl)formamide is an organic compound characterized by its amide functional group, which is derived from formic acid. This substance features a branched alkyl chain, specifically a 1,2,2-trimethylpropyl group, attached to the nitrogen atom of the amide. The presence of this bulky substituent can influence the compound's physical properties, such as its boiling point, solubility, and reactivity. Typically, amides exhibit moderate polarity due to the presence of the carbonyl group, which can engage in hydrogen bonding, affecting their solubility in polar solvents. N-(1,2,2-Trimethylpropyl)formamide may be utilized in various chemical applications, including as a solvent or intermediate in organic synthesis. Its safety profile, including toxicity and environmental impact, should be assessed before use, as with any chemical substance. Overall, the unique structure of this compound contributes to its potential utility in chemical processes and research.
Formula:C7H15NO
InChI:InChI=1/C7H15NO/c1-6(8-5-9)7(2,3)4/h5-6H,1-4H3,(H,8,9)
InChI key:InChIKey=NFBFERYHCPXWCC-UHFFFAOYSA-N
SMILES:C(C(C)(C)C)(NC=O)C
Synonyms:- N-(1,2,2-Trimethylpropyl)formamide
- Formamide, N-(1,2,2-trimethylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.