CAS 97364-15-3
:4-(1-hydroxyethyl)benzoic acid
Description:
4-(1-Hydroxyethyl)benzoic acid, identified by its CAS number 97364-15-3, is an organic compound that features a benzoic acid structure with a hydroxyethyl substituent at the para position. This compound is characterized by its carboxylic acid functional group, which imparts acidic properties, and the hydroxyethyl group, which contributes to its potential solubility in polar solvents. The presence of both the hydroxyl and carboxylic acid groups allows for hydrogen bonding, enhancing its reactivity and interaction with other molecules. Typically, this compound may exhibit moderate to high melting and boiling points due to its ability to form intermolecular hydrogen bonds. It is often used in various applications, including as an intermediate in organic synthesis and potentially in the formulation of pharmaceuticals or cosmetic products. The compound's stability, solubility, and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in practical applications.
Formula:C9H10O3
InChI:InChI=1/C9H10O3/c1-6(10)7-2-4-8(5-3-7)9(11)12/h2-6,10H,1H3,(H,11,12)
SMILES:CC(c1ccc(cc1)C(=O)O)O
Synonyms:- Benzoic Acid, 4-(1-Hydroxyethyl)-
- 4-(1-Hydroxyethyl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(1-Hydroxyethyl)benzoic acid
CAS:Formula:C9H10O3Purity:97%Color and Shape:SolidMolecular weight:166.17394-(1-Hydroxy-ethyl)-benzoic acid
CAS:4-(1-Hydroxy-ethyl)-benzoic acidPurity:95%Molecular weight:166.17g/mol4-(1-Hydroxy-ethyl)-benzoic acid
CAS:4-(1-Hydroxy-ethyl)-benzoic acid (4-HBA) is a hydrophobic compound that is an inhibitor of cytochrome P450, which is an enzyme system in the liver and other organs. The inhibitory activity of 4-HBA is due to its binding to the active site of cytochrome P450. This molecule has been shown to be effective against ferredoxin and putidaredoxin, which are enzymes that play a role in electron transfer reactions. 4-(1-Hydroxy-ethyl)-benzoic acid binds to the residue on these enzymes without any effect on their function.
Formula:C9H10O3Purity:Min. 95%Molecular weight:166.17 g/mol4-(1-Hydroxyethyl)benzoic acid
CAS:Formula:C9H10O3Purity:97%Color and Shape:SolidMolecular weight:166.176



