CAS 97383-41-0

1-(phenylsulfonyl)cyclopropanecarboxylic acid

Description:

1-(Phenylsulfonyl)cyclopropanecarboxylic acid is an organic compound characterized by its cyclopropane structure, which is a three-membered carbon ring. The presence of a phenylsulfonyl group indicates that the compound contains a sulfonyl functional group (-SO2-) attached to a phenyl ring, contributing to its reactivity and potential applications in organic synthesis. The carboxylic acid functional group (-COOH) provides acidic properties, allowing for proton donation in chemical reactions. This compound is typically used in pharmaceutical chemistry and may serve as an intermediate in the synthesis of various biologically active molecules. Its unique structure imparts specific steric and electronic properties, influencing its behavior in chemical reactions. Additionally, the presence of both the sulfonyl and carboxylic acid groups can enhance solubility in polar solvents, making it useful in various chemical environments. Overall, 1-(phenylsulfonyl)cyclopropanecarboxylic acid is a versatile compound with potential applications in medicinal chemistry and material science.

Formula: C₁₀H₁₀O₄S

InChI: InChI=1/C10H10O4S/c11-9(12)10(6-7-10)15(13,14)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12)

SMILES: c1ccc(cc1)S(=O)(=O)C1(CC1)C(=O)O

Synonyms:

• Cyclopropanecarboxylic Acid, 1-(Phenylsulfonyl)-

1-(phenylsulfonyl)cyclopropanecarboxylic acid

CAS: 97383-41-0

Formula: C₁₀H₁₀O₄S

Purity: 95.0%

Molecular weight: 226.25

Ref: 10-F313876

1-(Benzenesulfonyl)cyclopropane-1-carboxylic acid

CAS: 97383-41-0

1-(Benzenesulfonyl)cyclopropane-1-carboxylic acid is a cationic insecticide that is used in the control of insects. It is a chelator and non-caloric sweetener, which has been used as an intermediate to produce other compounds. 1-(Benzenesulfonyl)cyclopropane-1-carboxylic acid has been shown to be an effective insecticide when applied topically or orally. The compound also functions as a non-caloric sweetener that does not stimulate insulin secretion.

Formula: C₁₀H₁₀O₄S

Purity: Min. 95%

Molecular weight: 226.25 g/mol

Ref: 3D-XDA38341