CAS 97383-42-1

Methyl 1-(phenylsulfonyl)cyclopropanecarboxylate

Description:

Methyl 1-(phenylsulfonyl)cyclopropanecarboxylate is an organic compound characterized by its cyclopropane structure, which is a three-membered carbon ring. This compound features a carboxylate functional group, specifically a methyl ester, and a phenylsulfonyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the sulfonyl group enhances the electrophilic character of the molecule, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Methyl 1-(phenylsulfonyl)cyclopropanecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which facilitates its use in laboratory settings. The compound is of interest in medicinal chemistry and materials science due to its unique structural features and potential biological activities. As with many organic compounds, proper handling and safety precautions are essential, as it may pose health risks if ingested or inhaled.

Formula: C₁₁H₁₂O₄S

InChI: InChI=1S/C11H12O4S/c1-15-10(12)11(7-8-11)16(13,14)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3

InChI key: InChIKey=OACLWBSJZSLACO-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1(C(OC)=O)CC1)C2=CC=CC=C2

Synonyms:

• Cyclopropanecarboxylic acid, 1-(phenylsulfonyl)-, methyl ester
• Methyl 1-(phenylsulfonyl)cyclopropanecarboxylate