CAS 97389-25-8
:3-(4-hydroxyphenyl)-1,3-oxazolidin-2-one
Description:
3-(4-Hydroxyphenyl)-1,3-oxazolidin-2-one, with the CAS number 97389-25-8, is a chemical compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound typically exhibits properties such as being a solid at room temperature and may have moderate solubility in polar solvents due to the presence of the hydroxyl group. The hydroxyl group on the phenyl ring contributes to its potential as a hydrogen bond donor, influencing its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to known antibiotic agents. Additionally, its unique functional groups may impart specific biological activities, making it a candidate for further research in various applications, including drug design and synthesis. Overall, 3-(4-hydroxyphenyl)-1,3-oxazolidin-2-one represents a versatile scaffold for chemical exploration and potential therapeutic use.
Formula:C9H9NO3
InChI:InChI=1/C9H9NO3/c11-8-3-1-7(2-4-8)10-5-6-13-9(10)12/h1-4,11H,5-6H2
SMILES:c1cc(ccc1N1CCOC1=O)O
Synonyms:- 2-Oxazolidinone, 3-(4-Hydroxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.