CAS 97403-87-7
:Guanosine, guanylyl-(3′→5′)-, monoammonium salt
Description:
Guanosine, guanylyl-(3′→5′)-, monoammonium salt, commonly referred to as guanylyl guanosine or GMP (guanosine monophosphate) ammonium salt, is a nucleotide that plays a crucial role in cellular signaling and metabolism. It consists of a guanine base, a ribose sugar, and a phosphate group linked through a 3′ to 5′ phosphodiester bond. This compound is characterized by its ability to participate in various biochemical processes, including serving as a precursor for RNA synthesis and acting as a signaling molecule in the form of cyclic GMP (cGMP). The monoammonium salt form indicates the presence of ammonium ions, which can influence its solubility and stability in aqueous solutions. Guanylyl guanosine is also involved in the regulation of various physiological functions, including vasodilation and neurotransmission. Its structural features allow it to interact with specific enzymes and receptors, making it essential for numerous metabolic pathways. Overall, this compound is significant in both basic research and potential therapeutic applications.
Formula:C20H25N10O12P·H3N
InChI:InChI=1S/C20H25N10O12P.H3N/c21-19-25-13-7(15(35)27-19)23-3-29(13)17-10(33)9(32)6(41-17)2-39-43(37,38)42-12-5(1-31)40-18(11(12)34)30-4-24-8-14(30)26-20(22)28-16(8)36;/h3-6,9-12,17-18,31-34H,1-2H2,(H,37,38)(H3,21,25,27,35)(H3,22,26,28,36);1H3/t5-,6-,9-,10-,11-,12-,17-,18-;/m1./s1
InChI key:InChIKey=ONMZIZQHVXHGNH-AORRWANRSA-N
SMILES:O[C@H]1[C@H](N2C3=C(N=C2)C(=O)N=C(N)N3)O[C@H](CO)[C@H]1OP(OC[C@H]4O[C@H]([C@H](O)[C@@H]4O)N5C6=C(N=C5)C(=O)N=C(N)N6)(=O)O.N
Synonyms:- Guanosine, guanylyl-(3'.5')-, monoammonium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Guanylyl-3',5'-guanosine ammonium salt
CAS:<p>Guanylyl-3',5'-guanosine ammonium salt is a novel antiviral agent that has high antiviral activity against influenza A virus. It is a guanine derivative which has been modified to include an aminopropyl group and an ammonium cation. This compound also acts as an activator for deoxyribonucleosides, nucleotides, and ribonucleosides. Guanylyl-3',5'-guanosine ammonium salt may be used in the manufacture of DNA, RNA, and phosphoramidites. This compound also has anticancer effects by inhibiting the proliferation of tumor cells and inducing apoptosis.</p>Formula:C20H25N10O12P·H3NPurity:Min. 95%Molecular weight:645.48 g/mol
