CAS 97415-09-3
:benzyl (R)-(-)-mandelate
Description:
Benzyl (R)-(-)-mandelate is an organic compound characterized by its chiral structure, which is derived from mandelic acid. It features a benzyl group attached to the mandelate moiety, contributing to its unique properties. This compound is typically a white to off-white crystalline solid, and it is known for its solubility in organic solvents such as ethanol and acetone, while being less soluble in water. The presence of the chiral center imparts optical activity, making it significant in asymmetric synthesis and pharmaceutical applications. Benzyl (R)-(-)-mandelate can be utilized as a chiral auxiliary in various chemical reactions, enhancing the selectivity of the synthesis of other chiral compounds. Additionally, it may exhibit biological activity, which can be explored in medicinal chemistry. Its stability under standard laboratory conditions makes it a valuable compound for research and industrial applications. Proper handling and storage are essential due to its chemical nature, and safety data sheets should be consulted for specific handling guidelines.
Formula:C15H14O3
InChI:InChI=1/C15H14O3/c16-14(13-9-5-2-6-10-13)15(17)18-11-12-7-3-1-4-8-12/h1-10,14,16H,11H2/t14-/m1/s1
SMILES:c1ccc(cc1)COC(=O)[C@@H](c1ccccc1)O
Synonyms:- D-(-)-Mandelic acid benzyl ester
- benzyl (2R)-hydroxy(phenyl)ethanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzyl D-(-)-Mandelate
CAS:Formula:C15H14O3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:242.27(R)-Benzyl 2-hydroxy-2-phenylacetate
CAS:Formula:C15H14O3Purity:98%Color and Shape:SolidMolecular weight:242.2699(-)-Mandelic acid benzyl ester
CAS:<p>(-)-Mandelic acid benzyl ester is a natural product that can be used as a reference standard. The CAS number of (-)-Mandelic acid benzyl ester is 97415-09-3.</p>Formula:C15H14O3Color and Shape:SolidMolecular weight:242.3(R)-Benzyl 2-hydroxy-2-phenylacetate
CAS:Formula:C15H14O3Purity:98%Color and Shape:SolidMolecular weight:242.274




