CAS 97420-40-1
:2-Methyl-1H-benzimidazole-1-acetic acid hydrazide
Description:
2-Methyl-1H-benzimidazole-1-acetic acid hydrazide, with the CAS number 97420-40-1, is a chemical compound that features a benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound is characterized by the presence of a hydrazide functional group, which is indicative of its potential reactivity and biological activity. It typically exhibits properties such as moderate solubility in polar solvents and may have specific interactions with biological targets due to its structural features. The presence of the methyl group and the hydrazide moiety suggests that it may participate in various chemical reactions, including hydrazone formation and potential coordination with metal ions. Compounds of this nature are often studied for their pharmacological properties, including antimicrobial and anticancer activities. However, detailed studies are necessary to fully understand its behavior in biological systems and its potential applications in medicinal chemistry.
Formula:C10H12N4O
InChI:InChI=1S/C10H12N4O/c1-7-12-8-4-2-3-5-9(8)14(7)6-10(15)13-11/h2-5H,6,11H2,1H3,(H,13,15)
InChI key:InChIKey=VUMSWGDUJKYNFT-UHFFFAOYSA-N
SMILES:C(C(NN)=O)N1C=2C(N=C1C)=CC=CC2
Synonyms:- 2-(2-Methylbenzimidazol-1-yl)acetohydrazide
- 2-Methyl-1H-benzimidazole-1-acetic acid hydrazide
- 1H-Benzimidazole-1-acetic acid, 2-methyl-, hydrazide
- 2-(2-Methyl-1H-benzimidazol-1-yl)acetohydrazide
- (2-Methyl-benzoimidazol-1-yl)-acetic acid hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.