CAS 97426-53-4
:2-(p-Tolyl)thioacetamide
Description:
2-(p-Tolyl)thioacetamide, with the CAS number 97426-53-4, is an organic compound characterized by the presence of a thioamide functional group attached to a p-tolyl group. This compound features a sulfur atom bonded to a carbonyl carbon, which is further connected to an acetamide group. The p-tolyl group, derived from toluene, contributes to the compound's hydrophobic characteristics and can influence its solubility and reactivity. Typically, thioamides exhibit properties similar to amides but with distinct reactivity due to the presence of sulfur. This compound may be utilized in various chemical syntheses and research applications, particularly in the development of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety data should be consulted to understand its handling and potential hazards, as thioamides can sometimes be toxic or irritative.
Formula:C9H11NS
InChI:InChI=1/C9H11NS/c1-7-2-4-8(5-3-7)6-9(10)11/h2-5H,6H2,1H3,(H2,10,11)
SMILES:Cc1ccc(cc1)CC(=N)S
Synonyms:- 2-(4-Methylphenyl)ethanethioamide
- Benzeneethanethioamide, 4-Methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
