CAS 97451-46-2
:propan-2-yl L-gamma-glutamyl-L-cysteinylglycinate
Description:
Propan-2-yl L-gamma-glutamyl-L-cysteinylglycinate, also known by its CAS number 97451-46-2, is a synthetic peptide derivative that combines elements of amino acids and is characterized by its unique structure. This compound features a propan-2-yl group, which contributes to its hydrophobic properties, alongside a sequence of amino acids that includes L-gamma-glutamic acid, L-cysteine, and glycine. The presence of these amino acids suggests potential biological activity, possibly related to antioxidant properties due to the cysteine component, which contains a thiol group. The compound may exhibit solubility in polar solvents, and its stability can be influenced by pH and temperature. Additionally, it may play a role in biochemical pathways or serve as a building block for more complex molecules in pharmaceutical applications. However, specific data regarding its pharmacokinetics, toxicity, and therapeutic uses would require further investigation and empirical studies.
Formula:C13H23N3O6S
InChI:InChI=1/C13H23N3O6S/c1-7(2)22-11(18)5-15-12(19)9(6-23)16-10(17)4-3-8(14)13(20)21/h7-9,23H,3-6,14H2,1-2H3,(H,15,19)(H,16,17)(H,20,21)/t8-,9-/m0/s1
SMILES:CC(C)OC(=O)CN=C([C@H](CS)N=C(CC[C@@H](C(=O)O)N)O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Glutathione monoisopropyl ester
CAS:Glutathione monoisopropyl ester is a biochemical.Formula:C13H23N3O6SColor and Shape:SolidMolecular weight:349.40Glutathione-monoisopropyl ester (reduced)
CAS:This glutathione analog is more readily transported into cells than glutathione. It has been shown to reduce mortality in rats subjected to occlusion of the bilateral carotid arteries. This suggests that this compound possesses protective effects against cerebral ischemia, presumably due in part to inhibition of lipid peroxidative responses.
Formula:C13H23N3O6SColor and Shape:WhiteMolecular weight:349.41


