CAS 97460-20-3
:2-[4-(3-hydroxypropyl)piperazin-1-yl]ethyl [1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate
Description:
The chemical substance known as 2-[4-(3-hydroxypropyl)piperazin-1-yl]ethyl [1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indol-3-yl]acetate, with the CAS number 97460-20-3, is a complex organic compound characterized by its multi-functional structure. It features a piperazine moiety, which is often associated with various biological activities, including potential pharmacological effects. The presence of an indole ring, specifically substituted with a methoxy and chlorobenzoyl group, suggests that this compound may exhibit significant interactions with biological targets, potentially influencing neurotransmitter systems. The hydroxypropyl group enhances solubility and may contribute to the compound's pharmacokinetic properties. Overall, this substance is likely to be of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents targeting central nervous system disorders or other conditions. Its specific characteristics, such as solubility, stability, and biological activity, would require further investigation through empirical studies and characterization techniques.
Formula:C28H34ClN3O5
InChI:InChI=1/C28H34ClN3O5/c1-20-24(19-27(34)37-17-15-31-13-11-30(12-14-31)10-3-16-33)25-18-23(36-2)8-9-26(25)32(20)28(35)21-4-6-22(29)7-5-21/h4-9,18,33H,3,10-17,19H2,1-2H3
Synonyms:- 1H-Indole-3-acetic acid, 1-(4-chlorobenzoyl)-5-methoxy-2-methyl-, 2-(4-(3-hydroxypropyl)-1-piperazinyl)ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
