CAS 97461-81-9
:gly-arg-gly-asp
Description:
The chemical substance known as gly-arg-gly-asp, with the CAS number 97461-81-9, is a peptide composed of four amino acids: glycine (Gly), arginine (Arg), and aspartic acid (Asp). This peptide is often referred to as a part of the cell adhesion sequence, specifically the RGD (arginine-glycine-aspartic acid) motif, which is crucial for cell attachment and interaction with extracellular matrix proteins. Gly-arg-gly-asp exhibits characteristics typical of peptides, including solubility in water and the ability to form hydrogen bonds due to its polar amino acid side chains. It plays a significant role in biological processes such as cell signaling, migration, and proliferation. Additionally, this peptide can be utilized in various biomedical applications, including drug delivery systems and tissue engineering, due to its ability to promote cell adhesion and influence cellular behavior. Its stability and reactivity can be influenced by factors such as pH and temperature, which are important considerations in experimental and therapeutic contexts.
Formula:C14H25N7O7
InChI:InChI=1/C14H25N7O7/c15-5-9(22)20-7(2-1-3-18-14(16)17)12(26)19-6-10(23)21-8(13(27)28)4-11(24)25/h7-8H,1-6,15H2,(H,19,26)(H,20,22)(H,21,23)(H,24,25)(H,27,28)(H4,16,17,18)/t7-,8-/m0/s1
SMILES:C(C[C@@H](C(=NCC(=N[C@@H](CC(=O)O)C(=O)O)O)O)N=C(CN)O)CNC(=N)N
Synonyms:- H-Gly-Arg-Gly-Asp-OH
- glycyl-N~5~-(diaminomethylidene)-L-ornithylglycyl-L-aspartic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
GRGD-acid
CAS:GRGD-acid is a cell adhesive peptide containing the RGD motif. This enables it the ability to increase cell adhesion and rates of cell growth, differentiation and proliferation. When immobilised onto a Poly(etheretherketone) (PEEK) surface it has been shown to increase cell adhesion and proliferation in MC3T3-E1 cells. GRGD could therefore be used in dental implants.Formula:C14H25N7O7Color and Shape:PowderMolecular weight:403.39 g/molH-Gly-Arg-Gly-Asp-OH
CAS:H-Gly-Arg-Gly-Asp-OH is a cyclic peptide with the amino acid sequence of Gly-Arg-Gly-Asp. It has been shown to promote bone formation and inhibit bone resorption in vitro by stimulating the release of growth factors. This peptide can be used as a diagnostic agent for monitoring cell culture, which may be due to its ability to bind monoclonal antibodies. H-Gly-Arg-Gly-Asp-OH also has the ability to form conjugates with polymerase chain reaction (PCR) probes or other biomolecules. These conjugates can be used for detecting specific DNA sequences, such as those found in mammalian cells.
Formula:C14H25N7O7Purity:Min. 95%Molecular weight:403.39 g/mol
