CAS 97465-82-2

5-O-Methylhierochin D

Description:

5-O-Methylhierochin D, with the CAS number 97465-82-2, is a naturally occurring compound that belongs to the class of alkaloids. It is derived from various plant sources and is known for its potential biological activities, including antioxidant and antimicrobial properties. The structure of 5-O-Methylhierochin D features a methoxy group (-OCH3) at the 5-position of the hierochin backbone, which contributes to its chemical reactivity and interaction with biological systems. This compound is often studied for its pharmacological potential, particularly in traditional medicine contexts. Its solubility characteristics may vary depending on the solvent, and it is typically analyzed using techniques such as chromatography and spectroscopy to determine its purity and concentration. Research into 5-O-Methylhierochin D continues to explore its mechanisms of action and potential therapeutic applications, making it a subject of interest in both organic chemistry and pharmacology.

Formula: C₂₀H₂₂O₆

InChI: InChI=1S/C20H22O6/c1-24-17-10-13(5-6-16(17)23)19-15(11-22)14-8-12(4-3-7-21)9-18(25-2)20(14)26-19/h3-6,8-10,15,19,21-23H,7,11H2,1-2H3/b4-3+/t15-,19+/m0/s1

InChI key: KUSXBOZNRPQEON-LNFBDUAVSA-N

SMILES: COC1=CC(=CC2=C1O[C@@H]([C@H]2CO)C3=CC(=C(C=C3)O)OC)/C=C/CO

Synonyms:

• 5-O-Methylhierochin D
• (2S,3R)-2,3-dihydro-2-(4-hydroxy-3-methoxyphenyl)-5-[(E)-3-hydroxy-1-propenyl]-3-hydroxymethyl-7-methoxybenzo[b]furan
• 3-Benzofuranmethanol, 2,3-dihydro-2-(4-hydroxy-3-methoxyphenyl)-5-[(1E)-3-hydroxy-1-propen-1-yl]-7-methoxy-, (2S,3R)-