CAS 97466-90-5
:Quinelorane
Description:
Quinelorane, with the CAS number 97466-90-5, is a chemical compound that belongs to the class of quinoline derivatives. It is primarily recognized for its role as a selective dopamine D4 receptor agonist, which has implications in neuropharmacology and potential therapeutic applications in treating various psychiatric disorders. The compound exhibits a complex molecular structure that contributes to its biological activity, characterized by a quinoline ring system fused with other functional groups. Quinelorane's pharmacological profile includes effects on neurotransmitter systems, particularly in modulating dopamine pathways, which are crucial for mood regulation and cognitive functions. Additionally, it has been studied for its potential effects on locomotor activity and its influence on reward-related behaviors. As with many compounds that interact with the central nervous system, understanding its safety profile, efficacy, and potential side effects is essential for any therapeutic development. Overall, Quinelorane represents a significant interest in medicinal chemistry and pharmacology due to its selective action on dopamine receptors.
Formula:C14H22N4
InChI:InChI=1S/C14H22N4/c1-2-5-18-6-3-4-10-7-12-11(8-13(10)18)9-16-14(15)17-12/h9-10,13H,2-8H2,1H3,(H2,15,16,17)/t10-,13-/m1/s1
InChI key:InChIKey=TUFADSGTJUOBEH-ZWNOBZJWSA-N
SMILES:C(CC)N1[C@]2([C@@](CC=3C(C2)=CN=C(N)N3)(CCC1)[H])[H]
Synonyms:- (5aR,9aR)-5,5a,6,7,8,9,9a,10-Octahydro-6-propylpyrido[2,3-g]quinazolin-2-amine
- (5aR,9aR)-6-propyl-5,5a,6,7,8,9,9a,10-octahydropyrido[2,3-g]quinazolin-2-amine
- (5aR-trans)-5,5a,6,7,8,9,9a,10-Octahydro-6-propylpyrido(2,3-g)quinazolin-2-amine
- Ly 163502
- Pyrido(2,3-g)quinazolin-2-amine, 5,5a,6,7,8,9,9a,10-octahydro-6-propyl-, (5aR-trans)-
- Pyrido[2,3-g]quinazolin-2-amine, 5,5a,6,7,8,9,9a,10-octahydro-6-propyl-, (5aR,9aR)-
- Quinelorane [INN:BAN]
- Quinelorano
- Quinelorano [INN-Spanish]
- Quineloranum
- Quineloranum [INN-Latin]
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Quinelorane
CAS:<p>Quinelorane is dextrorotary isomer.</p>Formula:C14H22N4Color and Shape:SolidMolecular weight:246.35
