CymitQuimica logo

CAS 97467-66-8

:

Octadecanoic acid, 3,6,9,12,15,18-hexaoxaeicosane-1,20-diyl ester

Description:
Octadecanoic acid, 3,6,9,12,15,18-hexaoxaeicosane-1,20-diyl ester, commonly known as a fatty acid ester, is a chemical compound characterized by its long hydrocarbon chain derived from octadecanoic acid (also known as stearic acid) and a polyether structure. This compound features a backbone of 20 carbon atoms with six ether linkages, which contribute to its unique properties. It is typically a waxy solid at room temperature and is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of multiple ether groups enhances its thermal stability and may impart some degree of flexibility to the molecular structure. This compound is often studied for its potential applications in biocompatible materials, lubricants, and surfactants due to its favorable characteristics, including low toxicity and biodegradability. Its specific interactions and behavior in various environments can be influenced by the length of the hydrocarbon chain and the arrangement of the ether linkages.
Formula:C50H98O10
InChI:InChI=1S/C50H98O10/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-49(51)59-47-45-57-43-41-55-39-37-53-35-36-54-38-40-56-42-44-58-46-48-60-50(52)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h3-48H2,1-2H3
InChI key:InChIKey=UIXPZXWQZJBLMD-UHFFFAOYSA-N
SMILES:O(C(CCCCCCCCCCCCCCCCC)=O)CCOCCOCCOCCOCCOCCOCCOC(CCCCCCCCCCCCCCCCC)=O
Synonyms:
  • Octadecanoic acid, 3,6,9,12,15,18-hexaoxaeicosane-1,20-diyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.