CAS 97480-37-0

(Diethoxy-phosphoryl)difluoroacetic acid

Description:

(Diethoxy-phosphoryl)difluoroacetic acid is a chemical compound characterized by its unique structure, which includes a phosphoryl group and two ethoxy groups attached to a difluoroacetic acid moiety. This compound typically exhibits properties associated with both organophosphorus and carboxylic acid functionalities. It is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the difluoroacetic acid component suggests potential acidity, while the ethoxy groups may impart some degree of hydrophobicity and influence solubility in organic solvents. As a phosphoryl compound, it may also exhibit reactivity typical of organophosphorus compounds, including potential interactions with nucleophiles. Its applications could span various fields, including agrochemicals, pharmaceuticals, or as intermediates in organic synthesis. However, specific handling precautions should be observed due to the potential toxicity associated with organophosphorus compounds. Always refer to safety data sheets and relevant literature for detailed information on handling and applications.

Formula: C₆H₁₁F₂O₅P

InChI: InChI=1/C6H11F2O5P/c1-3-12-14(11,13-4-2)6(7,8)5(9)10/h3-4H2,1-2H3,(H,9,10)

SMILES: CCOP(=O)(C(C(=O)O)(F)F)OCC