CymitQuimica logo

CAS 97482-20-7

:

5,6,7,8-Tetrahydropyrido[2,3-d]pyrimidin-2-amine

Description:
5,6,7,8-Tetrahydropyrido[2,3-d]pyrimidin-2-amine is a heterocyclic organic compound characterized by its bicyclic structure, which incorporates both a pyridine and a pyrimidine ring. This compound features a tetrahydro configuration, indicating that it has four hydrogen atoms added to the rings, resulting in a saturated structure. The presence of an amino group (-NH2) at the 2-position of the pyrimidine ring contributes to its basicity and potential reactivity, making it a candidate for various biological activities. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its unique structure allows for potential interactions with biological targets, which has garnered interest in medicinal chemistry for applications in drug development. Additionally, the compound's CAS number, 97482-20-7, serves as a unique identifier for regulatory and research purposes, facilitating its study and application in various scientific fields.
Formula:C7H10N4
InChI:InChI=1S/C7H10N4/c8-7-10-4-5-2-1-3-9-6(5)11-7/h4H,1-3H2,(H3,8,9,10,11)
InChI key:InChIKey=JMHMEOOBIFYRQC-UHFFFAOYSA-N
SMILES:NC=1NC=2C(=CN1)CCCN2
Synonyms:
  • Pyrido[2,3-d]pyrimidin-2-amine, 1,5,6,7-tetrahydro-
  • 5,6,7,8-Tetrahydropyrido[2,3-d]pyrimidin-2-amine
  • 1,5,6,7-Tetrahydropyrido[2,3-d]pyrimidin-2-amine
  • Pyrido[2,3-d]pyrimidin-2-amine, 5,6,7,8-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.