CAS 97484-75-8
:1-(prop-2-en-1-yl)-2H-pyrido[2,3-d][1,3]oxazine-2,4(1H)-dione
Description:
1-(Prop-2-en-1-yl)-2H-pyrido[2,3-d][1,3]oxazine-2,4(1H)-dione, with the CAS number 97484-75-8, is a heterocyclic organic compound characterized by its complex structure that includes a pyridine ring fused with an oxazine moiety. This compound features a prop-2-en-1-yl substituent, which contributes to its reactivity and potential applications in organic synthesis. The presence of the dione functional groups indicates that it can participate in various chemical reactions, including nucleophilic additions and cycloadditions. Its unique structure may impart specific biological activities, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate solubility in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. As with many heterocycles, it may also display interesting electronic properties due to the conjugated system within its structure. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C10H8N2O3
InChI:InChI=1/C10H8N2O3/c1-2-6-12-8-7(4-3-5-11-8)9(13)15-10(12)14/h2-5H,1,6H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.