CymitQuimica logo

CAS 975-18-8

:

4-Butyl-1,2-dihydro-5-hydroxy-2-(4-hydroxyphenyl)-1-phenyl-3H-pyrazol-3-one

Description:
4-Butyl-1,2-dihydro-5-hydroxy-2-(4-hydroxyphenyl)-1-phenyl-3H-pyrazol-3-one, with the CAS number 975-18-8, is a chemical compound that belongs to the class of pyrazolone derivatives. This substance typically exhibits a complex structure characterized by a pyrazolone ring, which is a five-membered ring containing two nitrogen atoms. The presence of hydroxyl groups in its structure suggests that it may exhibit phenolic properties, potentially contributing to its reactivity and solubility in various solvents. The butyl group enhances its hydrophobic characteristics, which can influence its biological activity and interaction with other molecules. This compound may possess antioxidant properties due to the presence of the hydroxyl groups, making it of interest in pharmaceutical and biochemical research. Additionally, its unique structure may allow for various applications in organic synthesis and material science. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C19H20N2O3
InChI:InChI=1S/C19H20N2O3/c1-2-3-9-17-18(23)20(14-7-5-4-6-8-14)21(19(17)24)15-10-12-16(22)13-11-15/h4-8,10-13,22-23H,2-3,9H2,1H3
InChI key:InChIKey=WNZMBSXOXDPLRO-UHFFFAOYSA-N
SMILES:O=C1N(N(C(O)=C1CCCC)C2=CC=CC=C2)C3=CC=C(O)C=C3
Synonyms:
  • 3H-Pyrazol-3-one, 4-butyl-1,2-dihydro-5-hydroxy-2-(4-hydroxyphenyl)-1-phenyl-
  • 4-Butyl-1,2-dihydro-5-hydroxy-2-(4-hydroxyphenyl)-1-phenyl-3H-pyrazol-3-one
  • 3-Pyrazolin-5-one, 4-butyl-3-hydroxy-1-(p-hydroxyphenyl)-2-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.