CAS 975-77-9
:Sarpagan-17-oic acid, methyl ester, (16S)-
Description:
Sarpagan-17-oic acid, methyl ester, (16S)-, with the CAS number 975-77-9, is a chemical compound that belongs to the class of fatty acids and their esters. It is characterized by a long hydrocarbon chain, which contributes to its hydrophobic properties, making it less soluble in water but more soluble in organic solvents. The presence of the methyl ester functional group indicates that it is an ester derivative of a carboxylic acid, which typically enhances its volatility and reactivity compared to the parent acid. The specific stereochemistry denoted by (16S) suggests a particular spatial arrangement of atoms, which can influence the compound's biological activity and interactions. Sarpagan-17-oic acid, methyl ester, may be of interest in various fields, including organic synthesis, pharmaceuticals, and biochemistry, due to its potential applications in the development of bioactive compounds or as a building block in chemical synthesis. Its properties, such as melting point, boiling point, and reactivity, would depend on the specific molecular structure and functional groups present.
Formula:C20H22N2O2
InChI:InChI=1S/C20H22N2O2/c1-3-11-10-22-16-9-14-12-6-4-5-7-15(12)21-19(14)17(22)8-13(11)18(16)20(23)24-2/h3-7,13,16-18,21H,8-10H2,1-2H3/b11-3-/t13-,16-,17-,18-/m0/s1
InChI key:InChIKey=VXRAIAAMNNTQES-RIVXQSEJSA-N
SMILES:C(OC)(=O)[C@@H]1[C@]2([N@@]3[C@](C4=C(C2)C=5C(N4)=CC=CC5)(C[C@]1(/C(=C\C)/C3)[H])[H])[H]
Synonyms:- (+)-Pericyclivine
- Pericyclivine
- Deformoakuammidine
- Akuammidine, deformo-
- Sarpagan-17-oic acid, methyl ester, (16S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pericyclivine
CAS:Pericyclivine is a catharanthus alkaloid from Catharanthus roseus.Formula:C20H22N2O2Color and Shape:SolidMolecular weight:322.408
