CymitQuimica logo

CAS 97505-36-7

:

S-(2-chlorobenzyl) diethylcarbamothioate - 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea (1:1)

Description:
S-(2-chlorobenzyl) diethylcarbamothioate - 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea (1:1), with the CAS number 97505-36-7, is a chemical compound that exhibits characteristics typical of both carbamothioate and urea derivatives. This compound is likely to possess a complex structure due to the presence of multiple functional groups, including a thioate and a urea moiety, which may contribute to its biological activity. The chlorinated aromatic rings suggest potential for significant interactions with biological targets, possibly influencing its efficacy as a pesticide or herbicide. The presence of diethylcarbamothioate indicates potential for moderate to high lipophilicity, which can affect its solubility and bioavailability. Additionally, the compound may exhibit specific reactivity patterns due to the presence of the chlorobenzyl and dichlorophenyl groups, which can influence its stability and degradation pathways in environmental contexts. Overall, this compound's unique structural features suggest it may have specialized applications in agricultural chemistry or medicinal chemistry, warranting further investigation into its properties and potential uses.
Formula:C21H26Cl3N3O3S
InChI:InChI=1/C12H16ClNOS.C9H10Cl2N2O2/c1-3-14(4-2)12(15)16-9-10-7-5-6-8-11(10)13;1-13(15-2)9(14)12-6-3-4-7(10)8(11)5-6/h5-8H,3-4,9H2,1-2H3;3-5H,1-2H3,(H,12,14)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.