CAS 97511-09-6

1-[4-(1-Methylethyl)-2-thienyl]ethanone

Description:

1-[4-(1-Methylethyl)-2-thienyl]ethanone, also known by its CAS number 97511-09-6, is an organic compound characterized by its thienyl and ketone functional groups. This substance features a thienyl ring, which is a five-membered aromatic ring containing sulfur, contributing to its unique chemical properties. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, influencing its solubility and reactivity. Typically, compounds like this may exhibit interesting biological activities, making them of interest in fields such as medicinal chemistry and materials science. The molecular structure suggests potential applications in organic synthesis and as intermediates in the production of more complex molecules. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the thienyl and isopropyl groups, which may affect its interactions in various chemical environments. Overall, 1-[4-(1-Methylethyl)-2-thienyl]ethanone represents a class of compounds that can be explored for diverse applications in research and industry.

Formula: C₉H₁₂OS

InChI: InChI=1S/C9H12OS/c1-6(2)8-4-9(7(3)10)11-5-8/h4-6H,1-3H3

InChI key: InChIKey=FNQSLUZLSAUUDA-UHFFFAOYSA-N

SMILES: C(C)(C)C=1C=C(C(C)=O)SC1

Synonyms:

• 1-(4-Isopropylthiophen-2-yl)ethanone
• 1-[4-(1-Methylethyl)-2-thienyl]ethanone
• Ethanone, 1-[4-(1-methylethyl)-2-thienyl]-
• 1-[4-(Propan-2-yl)thiophen-2-yl]ethan-1-one