CAS 97552-83-5

Heptanedioic acid, nitro-, compd. with 2,2′-iminobis[ethanol] (1:2)

Description:

Heptanedioic acid, nitro-, compd. with 2,2′-iminobis[ethanol] (1:2), identified by CAS number 97552-83-5, is a chemical compound that features a heptanedioic acid backbone modified with nitro groups, indicating the presence of nitro functional groups (-NO2) attached to the heptanedioic acid structure. This compound is also complexed with 2,2′-iminobis[ethanol], which suggests the formation of a coordination complex or salt involving the amine and hydroxyl functionalities of the ethanol derivative. The presence of both the dicarboxylic acid and the nitro group may impart unique properties such as increased polarity and potential reactivity, making it of interest in various chemical applications, including synthesis and material science. The compound's structure may influence its solubility, stability, and interaction with other chemical species. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₇H₁₁NO₆·2C₄H₁₁NO₂

InChI: InChI=1/C7H11NO6.2C4H11NO2/c9-6(10)4-2-1-3-5(7(11)12)8(13)14;2*6-3-1-5-2-4-7/h5H,1-4H2,(H,9,10)(H,11,12);2*5-7H,1-4H2

Synonyms:

• Bis(bis(2-hydroxyethyl)ammonium) nitroheptanedioate
• 2-nitroheptanedioate
• bis(2-hydroxyethyl)ammonium
• Ethanol, 2,2′-iminobis-, nitroheptanedioate (2:1) (salt)
• Heptanedioic acid, nitro-, compd. with 2,2′-iminobis[ethanol] (1:2)