CAS 97555-82-3
:2-Propenoic acid, 2-methyl-, methyl ester, trimer
Description:
2-Propenoic acid, 2-methyl-, methyl ester, trimer, commonly known as methyl methacrylate trimer, is a chemical compound characterized by its structure derived from the polymerization of methyl methacrylate. This substance typically appears as a colorless to pale yellow liquid and is known for its low viscosity and good solubility in organic solvents. It exhibits a strong odor and is flammable, necessitating careful handling. The compound is primarily used in the production of polymers and resins, contributing to applications in coatings, adhesives, and plastics. Its reactivity is attributed to the presence of the methacrylate functional group, which can undergo further polymerization under appropriate conditions. Additionally, it may exhibit properties such as UV resistance and durability, making it suitable for various industrial applications. Safety considerations include potential skin and eye irritation, and it is advisable to use personal protective equipment when handling this substance. Overall, 2-Propenoic acid, 2-methyl-, methyl ester, trimer plays a significant role in the field of materials science and polymer chemistry.
Formula:(C5H8O2)3
InChI:InChI=1S/C5H8O2/c1-4(2)5(6)7-3/h1H2,2-3H3
InChI key:InChIKey=VVQNEPGJFQJSBK-UHFFFAOYSA-N
SMILES:C(C(C)=C)(OC)=O
Synonyms:- 2-Propenoic acid, 2-methyl-, methyl ester, trimer
- Methyl methacrylate, trimer
- Methacrylic acid, methyl ester, trimer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
