CAS 97558-62-8

ethyl 3-{3-fluoro-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoate

Description:

Ethyl 3-{3-fluoro-4-[2-hydroxy-3-(propan-2-ylamino)propoxy]phenyl}propanoate, with the CAS number 97558-62-8, is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group and a fluorinated aromatic ring. This compound features a propanoate moiety, indicating it is an ester derived from propanoic acid. The presence of a fluorine atom on the aromatic ring enhances its lipophilicity and may influence its biological activity. Additionally, the molecule contains a hydroxy group and an isopropylamino side chain, which can contribute to its solubility and potential interactions in biological systems. Such structural features suggest that this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and stability.

Formula: C₁₇H₂₆FNO₄

InChI: InChI=1/C17H26FNO4/c1-4-22-17(21)8-6-13-5-7-16(15(18)9-13)23-11-14(20)10-19-12(2)3/h5,7,9,12,14,19-20H,4,6,8,10-11H2,1-3H3

SMILES: CCOC(=O)CCc1ccc(c(c1)F)OCC(CNC(C)C)O

Synonyms:

• Benzenepropanoic acid, 3-fluoro-4-(2-hydroxy-3-((1-methylethyl)amino)propoxy)-, ethyl ester